Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Diphenyl ether, 99%
CAS: 101-84-8 Molecular Formula: C12H10O Molecular Weight (g/mol): 170.211 MDL Number: MFCD00003034 InChI Key: USIUVYZYUHIAEV-UHFFFAOYSA-N Synonym: diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl PubChem CID: 7583 ChEBI: CHEBI:39258 IUPAC Name: phenoxybenzene SMILES: C1=CC=C(C=C1)OC2=CC=CC=C2
| PubChem CID | 7583 |
|---|---|
| CAS | 101-84-8 |
| Molecular Weight (g/mol) | 170.211 |
| ChEBI | CHEBI:39258 |
| MDL Number | MFCD00003034 |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Synonym | diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl |
| IUPAC Name | phenoxybenzene |
| InChI Key | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| Molecular Formula | C12H10O |
Tartrazine
CAS: 1934-21-0 Molecular Formula: C16H9N4Na3O9S2 Molecular Weight (g/mol): 534.356 MDL Number: MFCD00148908 InChI Key: UJMBCXLDXJUMFB-UHFFFAOYSA-K Synonym: tartrazine,yellow 5,aizen tartrazine,trisodium salt,food yellow 4,tartrazine FD&C yellow #5,c.i. acid yellow 23,atul tartrazine,erio tartrazine,kako tartrazine PubChem CID: 164825 IUPAC Name: trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate SMILES: C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+]
| PubChem CID | 164825 |
|---|---|
| CAS | 1934-21-0 |
| Molecular Weight (g/mol) | 534.356 |
| MDL Number | MFCD00148908 |
| SMILES | C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+] |
| Synonym | tartrazine,yellow 5,aizen tartrazine,trisodium salt,food yellow 4,tartrazine FD&C yellow #5,c.i. acid yellow 23,atul tartrazine,erio tartrazine,kako tartrazine |
| IUPAC Name | trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate |
| InChI Key | UJMBCXLDXJUMFB-UHFFFAOYSA-K |
| Molecular Formula | C16H9N4Na3O9S2 |
Cefsulodin Sodium Salt MP Biomedicals
CAS: 52152-93-9 Molecular Formula: C22H21N4NaO8S2+ Molecular Weight (g/mol): 556.54 InChI Key: GTZPOHRNWUTXNB-DWBVFMGKSA-O PubChem CID: 124203950 IUPAC Name: (6R,7R)-3-[(4-carbamoylpyridin-1-ium-1-yl)methyl]-8-oxo-7-[[(2R)-2-phenyl-2-sulfoacetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;sodium SMILES: C1C(=C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)S(=O)(=O)O)C(=O)O)C[N+]4=CC=C(C=C4)C(=O)N.[Na]
| PubChem CID | 124203950 |
|---|---|
| CAS | 52152-93-9 |
| Molecular Weight (g/mol) | 556.54 |
| SMILES | C1C(=C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)S(=O)(=O)O)C(=O)O)C[N+]4=CC=C(C=C4)C(=O)N.[Na] |
| IUPAC Name | (6R,7R)-3-[(4-carbamoylpyridin-1-ium-1-yl)methyl]-8-oxo-7-[[(2R)-2-phenyl-2-sulfoacetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;sodium |
| InChI Key | GTZPOHRNWUTXNB-DWBVFMGKSA-O |
| Molecular Formula | C22H21N4NaO8S2+ |
2-Mercaptoethanol Molecular Biology MP Biomedicals
CAS: 60-24-2 Molecular Formula: C2H6OS Molecular Weight (g/mol): 78.13 MDL Number: MFCD00004890 InChI Key: DGVVWUTYPXICAM-UHFFFAOYSA-N Synonym: 2-mercaptoethanol,mercaptoethanol,thioglycol,beta-mercaptoethanol,ethanol, 2-mercapto,2-thioethanol,2-hydroxy-1-ethanethiol,thioethylene glycol,2-hydroxyethanethiol,2-hydroxyethyl mercaptan PubChem CID: 1567 ChEBI: CHEBI:41218 IUPAC Name: 2-sulfanylethan-1-ol SMILES: OCCS
| PubChem CID | 1567 |
|---|---|
| CAS | 60-24-2 |
| Molecular Weight (g/mol) | 78.13 |
| ChEBI | CHEBI:41218 |
| MDL Number | MFCD00004890 |
| SMILES | OCCS |
| Synonym | 2-mercaptoethanol,mercaptoethanol,thioglycol,beta-mercaptoethanol,ethanol, 2-mercapto,2-thioethanol,2-hydroxy-1-ethanethiol,thioethylene glycol,2-hydroxyethanethiol,2-hydroxyethyl mercaptan |
| IUPAC Name | 2-sulfanylethan-1-ol |
| InChI Key | DGVVWUTYPXICAM-UHFFFAOYSA-N |
| Molecular Formula | C2H6OS |
Tri-n-butyltin hydride, 97%
CAS: 688-73-3 Molecular Formula: C12H27Sn Molecular Weight (g/mol): 290.06 MDL Number: MFCD00009416 InChI Key: PIILXFBHQILWPS-UHFFFAOYSA-N Synonym: tributylstannanyl,tributlytin,tributylstannic hydride,tributyl tin,tri-n-butylstannane hydride,unii-4xdx163p3d,tin, tri-n-butyl-, hydride,tri-n-butylstannyl radical,stannane, tri-n-butyl-, hydride,tributyl-tin PubChem CID: 3032732 IUPAC Name: tributylstannyl SMILES: CCCC[Sn](CCCC)CCCC
| PubChem CID | 3032732 |
|---|---|
| CAS | 688-73-3 |
| Molecular Weight (g/mol) | 290.06 |
| MDL Number | MFCD00009416 |
| SMILES | CCCC[Sn](CCCC)CCCC |
| Synonym | tributylstannanyl,tributlytin,tributylstannic hydride,tributyl tin,tri-n-butylstannane hydride,unii-4xdx163p3d,tin, tri-n-butyl-, hydride,tri-n-butylstannyl radical,stannane, tri-n-butyl-, hydride,tributyl-tin |
| IUPAC Name | tributylstannyl |
| InChI Key | PIILXFBHQILWPS-UHFFFAOYSA-N |
| Molecular Formula | C12H27Sn |
Phorbol 12-myristate 13-acetate, 97%
CAS: 16561-29-8 Molecular Formula: C36H56O8 Molecular Weight (g/mol): 616.84 MDL Number: MFCD00036736 InChI Key: PHEDXBVPIONUQT-RGYGYFBISA-N Synonym: phorbol 12-myristate 13-acetate,phorbol ester,12-o-tetradecanoylphorbol-13-acetate,12-o-tetradecanoylphorbol 13-acetate,factor a1,tetradecanoylphorbol acetate,12-tetradecanoylphorbol 13-acetate,factor a1 croton oil,phorbol 13-acetate 12-myristate,phorbol-12-myristate-13-acetate PubChem CID: 27924 ChEBI: CHEBI:37537 IUPAC Name: (1S,2S,6R,10S,11R,13S,14R,15R)-13-(acetyloxy)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxotetracyclo[8.5.0.0²,⁶.0¹¹,¹³]pentadeca-3,8-dien-14-yl tetradecanoate SMILES: CCCCCCCCCCCCCC(=O)O[C@@H]1[C@@H](C)[C@]2(O)[C@@H]3C=C(C)C(=O)[C@@]3(O)CC(CO)=C[C@H]2[C@@H]2C(C)(C)[C@]12OC(C)=O
| PubChem CID | 27924 |
|---|---|
| CAS | 16561-29-8 |
| Molecular Weight (g/mol) | 616.84 |
| ChEBI | CHEBI:37537 |
| MDL Number | MFCD00036736 |
| SMILES | CCCCCCCCCCCCCC(=O)O[C@@H]1[C@@H](C)[C@]2(O)[C@@H]3C=C(C)C(=O)[C@@]3(O)CC(CO)=C[C@H]2[C@@H]2C(C)(C)[C@]12OC(C)=O |
| Synonym | phorbol 12-myristate 13-acetate,phorbol ester,12-o-tetradecanoylphorbol-13-acetate,12-o-tetradecanoylphorbol 13-acetate,factor a1,tetradecanoylphorbol acetate,12-tetradecanoylphorbol 13-acetate,factor a1 croton oil,phorbol 13-acetate 12-myristate,phorbol-12-myristate-13-acetate |
| IUPAC Name | (1S,2S,6R,10S,11R,13S,14R,15R)-13-(acetyloxy)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxotetracyclo[8.5.0.0²,⁶.0¹¹,¹³]pentadeca-3,8-dien-14-yl tetradecanoate |
| InChI Key | PHEDXBVPIONUQT-RGYGYFBISA-N |
| Molecular Formula | C36H56O8 |
Carbon Tetrachloride, 99+%, Spectroscopy Grade, Thermo Scientific™
CAS: 56-23-5 Molecular Formula: CCl4 Molecular Weight (g/mol): 153.81 MDL Number: MFCD00000785 InChI Key: VZGDMQKNWNREIO-UHFFFAOYSA-N Synonym: carbon tetrachloride,perchloromethane,tetrasol,methane, tetrachloro,vermoestricid,benzinoform,necatorine,tetrafinol,carbona,univerm PubChem CID: 5943 ChEBI: CHEBI:27385 IUPAC Name: tetrachloromethane SMILES: ClC(Cl)(Cl)Cl
| PubChem CID | 5943 |
|---|---|
| CAS | 56-23-5 |
| Molecular Weight (g/mol) | 153.81 |
| ChEBI | CHEBI:27385 |
| MDL Number | MFCD00000785 |
| SMILES | ClC(Cl)(Cl)Cl |
| Synonym | carbon tetrachloride,perchloromethane,tetrasol,methane, tetrachloro,vermoestricid,benzinoform,necatorine,tetrafinol,carbona,univerm |
| IUPAC Name | tetrachloromethane |
| InChI Key | VZGDMQKNWNREIO-UHFFFAOYSA-N |
| Molecular Formula | CCl4 |
Diacetyl 98.0+%, TCI America™
CAS: 431-03-8 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 MDL Number: MFCD00008756 InChI Key: QSJXEFYPDANLFS-UHFFFAOYSA-N Synonym: 2,3-butanedione,diacetyl,biacetyl,dimethylglyoxal,2,3-diketobutane,dimethyl glyoxal,butanedione,dimethyl diketone,2,3-butadione,2,3-dioxobutane PubChem CID: 650 ChEBI: CHEBI:16583 IUPAC Name: butane-2,3-dione SMILES: CC(=O)C(=O)C
| PubChem CID | 650 |
|---|---|
| CAS | 431-03-8 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:16583 |
| MDL Number | MFCD00008756 |
| SMILES | CC(=O)C(=O)C |
| Synonym | 2,3-butanedione,diacetyl,biacetyl,dimethylglyoxal,2,3-diketobutane,dimethyl glyoxal,butanedione,dimethyl diketone,2,3-butadione,2,3-dioxobutane |
| IUPAC Name | butane-2,3-dione |
| InChI Key | QSJXEFYPDANLFS-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
2,6-Di-tert-butyl-4-methylphenol, 99.8%
CAS: 128-37-0 Molecular Formula: C15H24O Molecular Weight (g/mol): 220.35 MDL Number: MFCD00011644 InChI Key: NLZUEZXRPGMBCV-UHFFFAOYSA-N Synonym: 2,6-di-tert-butyl-4-methylphenol,butylated hydroxytoluene,butylhydroxytoluene,2,6-di-tert-butyl-p-cresol,2,6-di-t-butyl-4-methylphenol,ionol,dbpc,dibunol,stavox,bht PubChem CID: 31404 ChEBI: CHEBI:34247 IUPAC Name: 2,6-ditert-butyl-4-methylphenol SMILES: CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C
| PubChem CID | 31404 |
|---|---|
| CAS | 128-37-0 |
| Molecular Weight (g/mol) | 220.35 |
| ChEBI | CHEBI:34247 |
| MDL Number | MFCD00011644 |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
| Synonym | 2,6-di-tert-butyl-4-methylphenol,butylated hydroxytoluene,butylhydroxytoluene,2,6-di-tert-butyl-p-cresol,2,6-di-t-butyl-4-methylphenol,ionol,dbpc,dibunol,stavox,bht |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol |
| InChI Key | NLZUEZXRPGMBCV-UHFFFAOYSA-N |
| Molecular Formula | C15H24O |
| CAS | 8001-25-0 |
|---|---|
| MDL Number | MFCD00131764 |
Allyl alcohol, 98+%
CAS: 107-18-6 Molecular Formula: C3H6O Molecular Weight (g/mol): 58.08 MDL Number: MFCD00002920 InChI Key: XXROGKLTLUQVRX-UHFFFAOYSA-N Synonym: allyl alcohol,2-propen-1-ol,vinylcarbinol,2-propenyl alcohol,3-hydroxypropene,2-propenol,allylic alcohol,1-propen-3-ol,vinyl carbinol,weed drench PubChem CID: 7858 ChEBI: CHEBI:16605 IUPAC Name: prop-2-en-1-ol SMILES: OCC=C
| PubChem CID | 7858 |
|---|---|
| CAS | 107-18-6 |
| Molecular Weight (g/mol) | 58.08 |
| ChEBI | CHEBI:16605 |
| MDL Number | MFCD00002920 |
| SMILES | OCC=C |
| Synonym | allyl alcohol,2-propen-1-ol,vinylcarbinol,2-propenyl alcohol,3-hydroxypropene,2-propenol,allylic alcohol,1-propen-3-ol,vinyl carbinol,weed drench |
| IUPAC Name | prop-2-en-1-ol |
| InChI Key | XXROGKLTLUQVRX-UHFFFAOYSA-N |
| Molecular Formula | C3H6O |
Dichloromethane, 99.8%, Extra Dry over Molecular Sieve, Stabilized, AcroSeal™
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Oxalyl chloride, 98%
CAS: 79-37-8 Molecular Formula: C2Cl2O2 Molecular Weight (g/mol): 126.93 MDL Number: MFCD00000704 InChI Key: CTSLXHKWHWQRSH-UHFFFAOYSA-N Synonym: oxalyl chloride,ethanedioyl dichloride,oxalic dichloride,oxaloyl chloride,oxalic acid dichloride,oxalic acid chloride,ethanedioyl chloride,oxalylchloride,unii-r4y96317dw,cocl 2 PubChem CID: 65578 IUPAC Name: oxalyl dichloride SMILES: C(=O)(C(=O)Cl)Cl
| PubChem CID | 65578 |
|---|---|
| CAS | 79-37-8 |
| Molecular Weight (g/mol) | 126.93 |
| MDL Number | MFCD00000704 |
| SMILES | C(=O)(C(=O)Cl)Cl |
| Synonym | oxalyl chloride,ethanedioyl dichloride,oxalic dichloride,oxaloyl chloride,oxalic acid dichloride,oxalic acid chloride,ethanedioyl chloride,oxalylchloride,unii-r4y96317dw,cocl 2 |
| IUPAC Name | oxalyl dichloride |
| InChI Key | CTSLXHKWHWQRSH-UHFFFAOYSA-N |
| Molecular Formula | C2Cl2O2 |
Thermo Scientific Chemicals Thiazolyl Blue tetrazolium bromide, 98%
CAS: 298-93-1 Molecular Formula: C18H16BrN5S Molecular Weight (g/mol): 414.33 MDL Number: MFCD00011964,MFCD00066662 InChI Key: AZKSAVLVSZKNRD-UHFFFAOYSA-M Synonym: thiazolyl blue,thiazolyl blue tetrazolium bromide,mmt tetrazolium,methylthiazoletetrazolium,mtt,thiazolyl blue monotetrazolium,thiazole blue,3-4,5-dimethylthiazol-2-yl-2,5-diphenyltetrazolium bromide,mtt van,unii-euy85h477i PubChem CID: 64965 ChEBI: CHEBI:53233 IUPAC Name: 2-(3,5-diphenyltetrazol-2-ium-2-yl)-4,5-dimethyl-1,3-thiazole;bromide SMILES: [Br-].CC1=C(C)N=C(S1)[N+]1=NC(=NN1C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 64965 |
|---|---|
| CAS | 298-93-1 |
| Molecular Weight (g/mol) | 414.33 |
| ChEBI | CHEBI:53233 |
| MDL Number | MFCD00011964,MFCD00066662 |
| SMILES | [Br-].CC1=C(C)N=C(S1)[N+]1=NC(=NN1C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | thiazolyl blue,thiazolyl blue tetrazolium bromide,mmt tetrazolium,methylthiazoletetrazolium,mtt,thiazolyl blue monotetrazolium,thiazole blue,3-4,5-dimethylthiazol-2-yl-2,5-diphenyltetrazolium bromide,mtt van,unii-euy85h477i |
| IUPAC Name | 2-(3,5-diphenyltetrazol-2-ium-2-yl)-4,5-dimethyl-1,3-thiazole;bromide |
| InChI Key | AZKSAVLVSZKNRD-UHFFFAOYSA-M |
| Molecular Formula | C18H16BrN5S |
Trioctylphosphine, 90%, technical grade, AcroSeal™
CAS: 4731-53-7 Molecular Formula: C24H51P Molecular Weight (g/mol): 370.64 InChI Key: RMZAYIKUYWXQPB-UHFFFAOYSA-N Synonym: trioctylphosphine,tri-n-octylphosphine,phosphine, trioctyl,tri-n-octyl phosphine,tri-octylphosphine,trioctyl phosphine,tri degrees ctylphosphine,acmc-209k8q PubChem CID: 20851 IUPAC Name: trioctylphosphane SMILES: CCCCCCCCP(CCCCCCCC)CCCCCCCC
| PubChem CID | 20851 |
|---|---|
| CAS | 4731-53-7 |
| Molecular Weight (g/mol) | 370.64 |
| SMILES | CCCCCCCCP(CCCCCCCC)CCCCCCCC |
| Synonym | trioctylphosphine,tri-n-octylphosphine,phosphine, trioctyl,tri-n-octyl phosphine,tri-octylphosphine,trioctyl phosphine,tri degrees ctylphosphine,acmc-209k8q |
| IUPAC Name | trioctylphosphane |
| InChI Key | RMZAYIKUYWXQPB-UHFFFAOYSA-N |
| Molecular Formula | C24H51P |